A3954812
Ethyl glyoxalate solution , 50%intoluene , 924-44-7
CAS NO.:924-44-7
Empirical Formula: C4H6O3
Molecular Weight: 102.09
MDL number: MFCD00044009
EINECS: 213-105-3
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB53.60 | In Stock |
|
| 100ML | RMB135.20 | In Stock |
|
| 500ML | RMB460.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110°C |
| Density | 1.03 g/mL at 20 °C |
| refractive index | 1.4750 |
| Flash point: | 7°C |
| storage temp. | Refrigerator |
| solubility | Chloroform, Ethyl Acetate |
| form | Oil |
| color | Clear Colorless |
| Water Solubility | Immiscible with water. |
| Sensitive | Air Sensitive |
| BRN | 1209486 |
| InChI | InChI=1S/C4H6O3/c1-2-7-4(6)3-5/h3H,2H2,1H3 |
| InChIKey | DBPFRRFGLYGEJI-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C=O |
| CAS DataBase Reference | 924-44-7(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, oxo-, ethyl ester (924-44-7) |
Description and Uses
Ethyl glyoxylate is widely used as an intermediate in the synthesis of pharmaceuticals (high reactivity of aldehyde function). It is used in the synthesis of a biodegradable polymer, poly(ethyl glyoxylate). It is actively involved in the Friedel-Crafts alkylation reactions with thiophenes to give the corresponding secondary alcohols.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H225-H315-H317-H361d |
| Precautionary statements | P280-P308+P313 |
| Hazard Codes | F,Xn |
| Risk Statements | 11-38-43-48/20-63-65-67 |
| Safety Statements | 36/37-62-16 |
| RIDADR | UN 1294 3/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | II |
| HS Code | 29183000 |
| REACH Registrations | Active |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |








