A3955512
Methyl 4-nitrobenzoate , 99% , 619-50-1
CAS NO.:619-50-1
Empirical Formula: C8H7NO4
Molecular Weight: 181.15
MDL number: MFCD00007350
EINECS: 210-599-2
| Pack Size | Price | Stock | Quantity |
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB199.20 | In Stock |
|
| 500G | RMB733.60 | In Stock |
|
| 2.5kg | RMB2399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 94-96 °C (lit.)
94-96 °C |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| Flash point: | 94-96°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Solubility in methanol is almost transparent. |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| BRN | 1912198 |
| InChI | 1S/C8H7NO4/c1-13-8(10)6-2-4-7(5-3-6)9(11)12/h2-5H,1H3 |
| InChIKey | YOJAHJGBFDPSDI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 619-50-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitrobenzoic acid methyl ester(619-50-1) |
| EPA Substance Registry System | Methyl-4-nitrobenzoate (619-50-1) |
Description and Uses
It is employed in the biochemical characterization of NfsA, the Escherichia coli major nitroreductase exhibiting a high amino acid sequence homology to Frp, a Vibrio harveyi flavin oxidoreductase.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DH5775000 |
| TSCA | TSCA listed |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |



