A3958512
2-Ethoxybenzoyl chloride , 98% , 42926-52-3
CAS NO.：42926-52-3
Empirical Formula: C9H9ClO2
Molecular Weight: 184.62
MDL number: MFCD00016348
EINECS: 256-003-4
| Pack Size | Price | Stock | Quantity |
| 25G | RMB80.80 | In Stock |
|
| 100G | RMB257.60 | In Stock |
|
| 500g | RMB1128.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 114-118°C 5mm |
| Density | 1.19 |
| refractive index | 1.553 |
| Flash point: | >110 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Benzene |
| form | clear liquid |
| color | Colorless to Light yellow |
| Sensitive | Moisture Sensitive |
| Stability: | Hygroscopic, Moisture sensitive |
| InChI | InChI=1S/C9H9ClO2/c1-2-12-8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | MDKAAWDKKBFSTK-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)C1=CC=CC=C1OCC |
| CAS DataBase Reference | 42926-52-3(CAS DataBase Reference) |
Description and Uses
2-Ethoxybenzoyl chloride can be used in organic synthesis and as a pharmaceutical intermediate in pharmaceutical synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34-22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| Hazard Note | Corrosive/Moisture Sensitive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2916399090 |
