A3965812
Es-fenvalerate , Analysis standard product, 99% , 66230-04-4
CAS NO.:66230-04-4
Empirical Formula: C25H22ClNO3
Molecular Weight: 419.91
MDL number: MFCD00203302
EINECS: 613-911-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 59°C |
| alpha | D25 -15.0° (c = 2.0 in CH3OH) |
| Boiling point: | 151-167°C |
| Density | d2323 1.163 |
| vapor pressure | 2×10-7 Pa (25 °C) |
| refractive index | 1.6500 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO : 100 mg/mL (238.15 mM; Need ultrasonic) |
| form | Solid |
| Water Solubility | 0.002 mg l-1 (25 °C) |
| color | White to light yellow |
| BRN | 4275674 |
| Major Application | agriculture environmental |
| InChI | 1S/C25H22ClNO3/c1-17(2)24(18-11-13-20(26)14-12-18)25(28)30-23(16-27)19-7-6-10-22(15-19)29-21-8-4-3-5-9-21/h3-15,17,23-24H,1-2H3/t23-,24+/m1/s1 |
| InChIKey | NYPJDWWKZLNGGM-RPWUZVMVSA-N |
| SMILES | CC(C)[C@H](C(=O)O[C@H](C#N)c1cccc(Oc2ccccc2)c1)c3ccc(Cl)cc3 |
| LogP | 6.220 |
| CAS DataBase Reference | 66230-04-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzeneacetic acid, 4-chloro-«alpha»-(1-methylethyl)-, cyano (3-phenoxyphenyl)methyl ester,(s-(r*,r*))-(66230-04-4) |
| EPA Substance Registry System | Esfenvalerate (66230-04-4) |
Description and Uses
Esfenvalerate is the most potent insecticidal isomer of Fenvalerate (F279450), a pyrethroid insecticide used to control insects from food crops, animal feed and cotton products.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301+H331-H317-H410 |
| Precautionary statements | P273-P280-P301+P310+P330-P302+P352-P304+P340+P311 |
| target organs | Nervous system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T;N,N,T |
| Risk Statements | 23/25-43-50/53 |
| Safety Statements | 24-36/37/39-45-60-61 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| RTECS | CY1576367 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Skin Sens. 1 STOT RE 2 STOT SE 1 |
| Hazardous Substances Data | 66230-04-4(Hazardous Substances Data) |
| Toxicity | LC50 (96-hour) for fathead minnows 0.69 mg/L (Worthing and Hance, 1991); acute oral LD50 for rats 75 mg/kg (Hartley and Kidd, 1987). |





![Cyanomethyl Formate [Formylating Reagent]](https://img.chemicalbook.com/CAS/GIF/150760-95-5.gif)


