A3966012
Etofenprox , Analysis standard , 80844-07-1
Synonym(s):
2-(4-Ethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether
CAS NO.:80844-07-1
Empirical Formula: C25H28O3
Molecular Weight: 376.49
MDL number: MFCD00210287
EINECS: 407-980-2
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB638.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 36.4-38.0° |
| Boiling point: | 445.03°C (rough estimate) |
| Density | 1.1386 (rough estimate) |
| vapor pressure | 32×10-3 Pa (100 °C) |
| refractive index | nD20.2 1.5732 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO: 100 mg/mL (265.61 mM) |
| form | Solid |
| Water Solubility | <0.001 mg l-1(25 °C) |
| color | Off-white to light yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | agriculture environmental |
| InChI | 1S/C25H28O3/c1-4-27-22-15-13-21(14-16-22)25(2,3)19-26-18-20-9-8-12-24(17-20)28-23-10-6-5-7-11-23/h5-17H,4,18-19H2,1-3H3 |
| InChIKey | YREQHYQNNWYQCJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(cc1)C(C)(C)COCc2cccc(Oc3ccccc3)c2 |
| CAS DataBase Reference | 80844-07-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Etofenprox(80844-07-1) |
| EPA Substance Registry System | Etofenprox (80844-07-1) |
Description and Uses
Insecticide.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Warning |
| Hazard statements | H362-H410 |
| Precautionary statements | P201-P260-P263-P273-P308+P313-P391 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| RTECS | DA0670000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Lact. |
| Toxicity | LD50 in rats, mice (mg/kg): >2880, >107200 orally; >2140, >2140 dermally |





