PRODUCT Properties
| Melting point: | 240-255 °C |
| Density | 1.14 g/mL at 25 °C (lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| solubility | esters, aromatic hydrocarbons, alcohols and ketones: soluble |
| form | powder |
| color | White to slightly yellow |
| Specific Gravity | 1.14 |
| Water Solubility | insoluble |
| Merck | 14,3781 |
| Dielectric constant | 2.8(Ambient) |
| InChI | InChI=1S/C23H24N6O4/c1-4-5-8-28(9-10-33-17(3)30)20-6-7-22(16(2)11-20)26-27-23-18(14-24)12-21(29(31)32)13-19(23)15-25/h6-7,11-13H,4-5,8-10H2,1-3H3/b27-26+ |
| InChIKey | ARSKJXYLLONUAJ-CYYJNZCTSA-N |
| SMILES | C(OCCN(CCCC)C1=CC=C(/N=N/C2=C(C#N)C=C([N+]([O-])=O)C=C2C#N)C(C)=C1)(=O)C |
| EPA Substance Registry System | Ethyl cellulose (9004-57-3) |
Description and Uses
In the manufacture of plastics and lacquers. Pharmaceutic aid (tablet binder).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H313-H319-H315-H303-H335-H412 |
| Precautionary statements | P312-P312-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P273-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | FJ5950500 |
| F | 3 |
| Autoignition Temperature | 698 °F |
| TSCA | Yes |
| HS Code | 39129000 |
| Hazardous Substances Data | 9004-57-3(Hazardous Substances Data) |






