A3969312
                    Ethyl cellulose , 180-220MPA.S, 5%toluene/isopropyl 80:20 , 9004-57-3
CAS NO.:9004-57-3
Empirical Formula: C23H24N6O4
Molecular Weight: 448.474
MDL number: MFCD00131037
EINECS: 618-384-9
| Pack Size | Price | Stock | Quantity | 
| 100G | RMB55.20 | In Stock | 
                                                 | 
                                        
| 500G | RMB204.00 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 240-255 °C | 
                                    
| Density | 1.14 g/mL at 25 °C (lit.) | 
                                    
| refractive index | n | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | esters, aromatic hydrocarbons, alcohols and ketones: soluble | 
                                    
| form | powder | 
                                    
| color | White to slightly yellow | 
                                    
| Specific Gravity | 1.14 | 
                                    
| Water Solubility | insoluble | 
                                    
| Merck | 14,3781 | 
                                    
| Dielectric constant | 2.8(Ambient) | 
                                    
| InChI | InChI=1S/C23H24N6O4/c1-4-5-8-28(9-10-33-17(3)30)20-6-7-22(16(2)11-20)26-27-23-18(14-24)12-21(29(31)32)13-19(23)15-25/h6-7,11-13H,4-5,8-10H2,1-3H3/b27-26+ | 
                                    
| InChIKey | ARSKJXYLLONUAJ-CYYJNZCTSA-N | 
                                    
| SMILES | C(OCCN(CCCC)C1=CC=C(/N=N/C2=C(C#N)C=C([N+]([O-])=O)C=C2C#N)C(C)=C1)(=O)C | 
                                    
| EPA Substance Registry System | Ethyl cellulose (9004-57-3) | 
                                    
Description and Uses
In the manufacture of plastics and lacquers. Pharmaceutic aid (tablet binder).
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H313-H319-H315-H303-H335-H412 | 
| Precautionary statements | P312-P312-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362-P273-P501 | 
| Hazard Codes | Xi | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 1 | 
| RTECS | FJ5950500 | 
| F | 3 | 
| Autoignition Temperature | 698 °F | 
| TSCA | Yes | 
| HS Code | 39129000 | 
| Hazardous Substances Data | 9004-57-3(Hazardous Substances Data) | 






