A3979012
Ethoxyquin , 90% , 91-53-2
Synonym(s):
1,2-Dihydro-6-ethoxy-2,2,4-trimethylquinoline;6-Ethoxy-1,2-dihydro-2,2,4-trimethylquinoline
CAS NO.:91-53-2
Empirical Formula: C14H19NO
Molecular Weight: 217.31
MDL number: MFCD00023883
EINECS: 202-075-7
| Pack Size | Price | Stock | Quantity |
| 25g | RMB29.60 | In Stock |
|
| 100G | RMB64.00 | In Stock |
|
| 500G | RMB212.80 | In Stock |
|
| 2.5kg | RMB783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <0°C |
| Boiling point: | 123-125°C |
| Density | 1.03 g/mL at 20 °C (lit.) |
| vapor pressure | 0.035Pa at 25℃ |
| refractive index | 1.569~1.571 |
| Flash point: | 137 °C |
| storage temp. | 2-8°C |
| solubility | ethanol: 50 mL/L, clear, brown |
| pka | 5.02±0.70(Predicted) |
| form | Liquid |
| color | Yellow to Very Dark Brown |
| Water Solubility | <0.1 g/100 mL at 20 ºC |
| Merck | 14,3753 |
| BRN | 158223 |
| Stability: | Stable. Combustible. Incompatible with oxidizing agents, strong acids. Polymerizes if heated. May polymerize upon exposure to light and air. |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C14H19NO/c1-5-16-11-6-7-13-12(8-11)10(2)9-14(3,4)15-13/h6-9,15H,5H2,1-4H3 |
| InChIKey | DECIPOUIJURFOJ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2NC(C)(C)C=C(C)c2c1 |
| LogP | 3.39 |
| CAS DataBase Reference | 91-53-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Quinoline, 6-ethoxy-1,2-dihydro-2,2,4-trimethyl-(91-53-2) |
| EPA Substance Registry System | Ethoxyquin (91-53-2) |
Description and Uses
Ethoxyquin is used as an antioxidant in animal feed and caused contact dermatitis in a worker at an animal feed mill.
Antioxidant in feed and food; antidegradation agent for rubber.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24 |
| RIDADR | 3082 |
| WGK Germany | 1 |
| RTECS | VB8225000 |
| F | 2-8-10 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29334900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 91-53-2(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats, mice: 1920, 1730 mg/kg (Piul'skaya) |





