A3984112
Ethylenediaminetetraacetic acid disodium salt solution , 0.05000mol/L(0.05M) , 139-33-3
Synonym(s):
EDTA disodium salt;Ethylenediaminetetraacetic acid disodium salt dihydrate;Disodium ethylenediaminetetraacetate dihydrate;Edathamil;Edetate disodium salt dihydrate
CAS NO.:139-33-3
Empirical Formula: C10H14N2Na2O8
Molecular Weight: 336.21
MDL number: MFCD00070672
EINECS: 205-358-3
| Pack Size | Price | Stock | Quantity |
| 1L | RMB87.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248 °C (dec.)(lit.) |
| Boiling point: | >100 °C |
| Density | 1.01 g/mL at 25 °C |
| vapor pressure | 0Pa at 25℃ |
| refractive index | n20/D 1.363 |
| storage temp. | 2-8°C |
| solubility | H2O: clear, colorless |
| form | solution |
| color | ≤5 (0.5 M)(APHA) |
| PH | 8.0±0.2 |
| Odor | at 100.00%. odorless |
| Water Solubility | Miscible with water. |
| BRN | 3822669 |
| Stability: | Hygroscopic |
| Cosmetics Ingredients Functions | CHELATING VISCOSITY CONTROLLING |
| Cosmetic Ingredient Review (CIR) | Ethylenediaminetetraacetic acid disodium salt (139-33-3) |
| InChI | 1S/C10H16N2O8.2Na/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);;/q;2*+1/p-2 |
| InChIKey | ZGTMUACCHSMWAC-UHFFFAOYSA-L |
| SMILES | [Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| LogP | -4.3 at 25℃ |
| CAS DataBase Reference | 139-33-3(CAS DataBase Reference) |
| EPA Substance Registry System | Ethylenediaminetetraacetic acid disodium salt (139-33-3) |
| Absorption | cut-off at 268nm |
Description and Uses
disodium EDTA is a preservative used in concentrations of 0.1 to 0.5 percent.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H303-H332-H372-H412 |
| Precautionary statements | P260-P271-P273-P304+P340+P312-P312-P501 |
| Hazard Codes | Xn,C |
| Risk Statements | 36/38-36/37/38-22-34-21/22 |
| Safety Statements | 26-36-37/39-45-36/37/39-36/37 |
| WGK Germany | 2 |
| RTECS | AH4410000 |
| TSCA | TSCA listed |
| HS Code | 29224999 |
| Storage Class | 12 - Non Combustible Liquids |
| Hazardous Substances Data | 139-33-3(Hazardous Substances Data) |
| Toxicity | mouse,LD50,intraperitoneal,260mg/kg (260mg/kg),Nippon Yakurigaku Zasshi. Japanese Journal of Pharmacology. Vol. 52, Pg. 126S, 1956. |






