A3989212
(R)-Ethyl piperidine-3-carboxylate , 98% , 25137-01-3
Synonym(s):
(R)-ethyl nipecotate;(R)-Piperidine-3-carboxylic acid ethyl ester
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB90.40 | In Stock |
|
| 25G | RMB319.20 | In Stock |
|
| 100G | RMB1015.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 110 °C / 20mmHg |
| Density | 1,02 g/cm3 |
| refractive index | -1.5 ° (C=neat) |
| Flash point: | 90 °C |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| form | clear liquid |
| pka | 9.35±0.10(Predicted) |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C8H15NO2/c1-2-11-8(10)7-4-3-5-9-6-7/h7,9H,2-6H2,1H3/t7-/m1/s1 |
| InChIKey | XIWBSOUNZWSFKU-SSDOTTSWSA-N |
| SMILES | N1CCC[C@@H](C(OCC)=O)C1 |
| CAS DataBase Reference | 25137-01-3(CAS DataBase Reference) |
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H315-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-41-37/38 |
| Safety Statements | 26-36/37/39-39-36 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 29333990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
