A3991112
Ethyl 2-aminothiazole-4-carboxylate , 98% , 5398-36-7
CAS NO.：5398-36-7
Empirical Formula: C6H8N2O2S
Molecular Weight: 172.2
MDL number: MFCD00619079
EINECS: 611-074-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB26.40 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25g | RMB136.00 | In Stock |
|
| 100G | RMB368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177 °C |
| Boiling point: | 308.0±15.0 °C(Predicted) |
| Density | 1.336±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 2.60±0.10(Predicted) |
| form | Solid |
| color | Pale Beige |
| λmax | 284nm(MeOH)(lit.) |
| InChI | InChI=1S/C6H8N2O2S/c1-2-10-5(9)4-3-11-6(7)8-4/h3H,2H2,1H3,(H2,7,8) |
| InChIKey | XHFUVBWCMLLKOZ-UHFFFAOYSA-N |
| SMILES | S1C=C(C(OCC)=O)N=C1N |
| CAS DataBase Reference | 5398-36-7(CAS DataBase Reference) |
Description and Uses
Ethyl 2-Amino-1,3-thiazole-4-carboxylate is a chemical reagent used in the preparation fo SAR thiazolamino arylaminopyrimidines as anaplastic lymphoma kinase inhibitors. As well as in the synthesis of 4-bicyclick piperadine derivatives as potent stearoyl-CoA desaturase (SCD1) inhibitors in the treatment of cancer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 24/25-36/37/39-26-22 |
| WGK Germany | nwg |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
