A3993112
Ethylboronic acid , 98% , 4433-63-0
CAS NO.：4433-63-0
Empirical Formula: C2H7BO2
Molecular Weight: 73.89
MDL number: MFCD01074536
EINECS: 670-253-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB212.00 | In Stock |
|
| 100G | RMB799.20 | In Stock |
|
| 500g | RMB3304.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 161-162°C |
| Boiling point: | 154.0±23.0 °C(Predicted) |
| Density | 0.941±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Water (Slightly) |
| pka | 10.18±0.43(Predicted) |
| form | Crystalline Powder, Needles or Flakes |
| color | White to slightly yellow |
| Sensitive | Hygroscopic |
| BRN | 1731546 |
| InChI | InChI=1S/C2H7BO2/c1-2-3(4)5/h4-5H,2H2,1H3 |
| InChIKey | PAVZHTXVORCEHP-UHFFFAOYSA-N |
| SMILES | C(B(O)O)C |
| CAS DataBase Reference | 4433-63-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethyldihydroxyborane(4433-63-0) |
Description and Uses
Ethylboronic Acid is the sole precursor in the successful preparation of boron-doped graphene (B-doped graphene) films with large area.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280g-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36 |
| TSCA | No |
| HazardClass | IRRITANT, KEEP COLD |
| HS Code | 29319090 |
