A3998812
Ethyl 1,3-dimethyl-1H-pyrazole-5-carboxylate , 95% , 5744-40-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB112.00 | In Stock |
|
| 25g | RMB451.20 | In Stock |
|
| 100g | RMB17279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 40-42 °C |
| Boiling point: | 80°C 1mm |
| Density | 1.12±0.1 g/cm3(Predicted) |
| refractive index | 1.4790 to 1.4830 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 1.03±0.10(Predicted) |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C8H12N2O2/c1-4-12-8(11)7-5-6(2)9-10(7)3/h5H,4H2,1-3H3 |
| InChIKey | ZYSGPOXVDOROJU-UHFFFAOYSA-N |
| SMILES | N1(C)C(C(OCC)=O)=CC(C)=N1 |
| CAS DataBase Reference | 5744-40-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 24/25-36/37/39-26-23 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |







