A4000112
Ethyl 2-amino-4-methylthiophene-3-carboxylate , 98% , 43088-42-2
CAS NO.:43088-42-2
Empirical Formula: C8H11NO2S
Molecular Weight: 185.24
MDL number: MFCD00051669
EINECS: 674-825-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.00 | In Stock |
|
| 1G | RMB50.40 | In Stock |
|
| 5G | RMB255.60 | In Stock |
|
| 25G | RMB1062.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80 °C |
| Boiling point: | 279℃ |
| Density | 1.219 |
| Flash point: | 123℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 0.24±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| BRN | 1366073 |
| InChI | InChI=1S/C8H11NO2S/c1-3-11-8(10)6-5(2)4-12-7(6)9/h4H,3,9H2,1-2H3 |
| InChIKey | ILYCZKOBLRJJSW-UHFFFAOYSA-N |
| SMILES | C1(N)SC=C(C)C=1C(OCC)=O |
| CAS DataBase Reference | 43088-42-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Safety Statements | 24/25 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |







