A4001312
Ethoxycarbonyl isothiocyanate , 98% , 16182-04-0
Synonym(s):
Ethyl isothiocyanatoformate
CAS NO.:16182-04-0
Empirical Formula: C4H5NO2S
Molecular Weight: 131.15
MDL number: MFCD00004814
EINECS: 240-318-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB31.20 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB284.00 | In Stock |
|
| 100G | RMB979.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 56 °C18 mm Hg(lit.) |
| Density | 1.112 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 123 °F |
| storage temp. | 2-8°C |
| solubility | Soluble in chloroform and ether. |
| form | Oil |
| color | Light Yellow |
| Specific Gravity | 1.112 |
| Sensitive | Moisture Sensitive/Lachrymatory |
| BRN | 606091 |
| InChI | InChI=1S/C4H5NO2S/c1-2-7-4(6)5-3-8/h2H2,1H3 |
| InChIKey | BDTDECDAHYOJRO-UHFFFAOYSA-N |
| SMILES | C(N=C=S)(=O)OCC |
| CAS DataBase Reference | 16182-04-0(CAS DataBase Reference) |
Description and Uses
Ethoxycarbonyl isothiocyanate has been used in the synthesis of:
- pyrazolo[1,5-a][1,3,5]triazine derivatives, potential inhibitors of protein kinase CK2
- fused thiophene derivatives, having antibacterial and antifungal activities
- 4-thiouracil derivatives
- thiocarbamides from stannylarenes
- 1,3,5-triazin-2-one-4-thiones from 2-amino-2-oxazolines
- N-acylthioureas from aminodeoxy sugars
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H315-H317-H319-H331-H334-H335 |
| Precautionary statements | P210-P280-P302+P352-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T,Xi |
| Risk Statements | 23-36/37/38-42 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 2929 6.1/PG 2 |
| WGK Germany | 3 |
| F | 9-13-19-21 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Inhalation Eye Irrit. 2 Flam. Liq. 3 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |







