A4002012
Ethyl imidazole-2-carboxylate , 98%(GC) , 33543-78-1
CAS NO.:33543-78-1
Empirical Formula: C6H8N2O2
Molecular Weight: 140.14
MDL number: MFCD03426031
EINECS: 681-997-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB264.80 | In Stock |
|
| 25g | RMB679.20 | In Stock |
|
| 5G | RMB1028.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 176-178°C |
| Boiling point: | 48-51°C 0,3mm |
| Density | 1.214±0.06 g/cm3(Predicted) |
| Flash point: | 48-51°C/0.3mm |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.38±0.10(Predicted) |
| color | Off-White to Pale Beige |
| BRN | 115685 |
| InChI | InChI=1S/C6H8N2O2/c1-2-10-6(9)5-7-3-4-8-5/h3-4H,2H2,1H3,(H,7,8) |
| InChIKey | UHYNYIGCGVDBTC-UHFFFAOYSA-N |
| SMILES | C1(C(OCC)=O)NC=CN=1 |
| CAS DataBase Reference | 33543-78-1(CAS DataBase Reference) |
Description and Uses
Ethyl Imidazole-2-carboxylate is an intermediate used to synthesize tricyclic quinoxalinone inhibitors of poly(ADP-ribose)polymerase-1 (PARP-1). It is also used to prepare imidazoindenopyrazinone carboxylic acid derivatives as AMPA antagonists with anticonvulsant activities.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| Hazard Note | Irritant |
| HS Code | 29332900 |





![7-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)imidazo[1,2-a]pyridine](https://img.chemicalbook.com/CAS/GIF/908268-52-0.gif)

