A4008756
Lynestrenol , ≥98% , 52-76-6
Synonym(s):
(17α)-19-Norpregn-4-en-20-yn-17-ol
CAS NO.:52-76-6
Empirical Formula: C20H28O
Molecular Weight: 284.44
MDL number: MFCD00051135
EINECS: 200-151-4
| Pack Size | Price | Stock | Quantity |
| 50mg | RMB159.20 | In Stock |
|
| 250mg | RMB308.80 | In Stock |
|
| 1g | RMB806.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158°C |
| alpha | D -13° (chloroform) |
| Boiling point: | 366.92°C (rough estimate) |
| Density | 1.0083 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, soluble in acetone and in ethanol (96 per cent). |
| pka | 13.12±0.40(Predicted) |
| form | Solid |
| color | Crystals from MeOH |
| Merck | 14,5629 |
| Major Application | pharmaceutical (small molecule) |
| InChI | 1S/C20H28O/c1-3-20(21)13-11-18-17-9-8-14-6-4-5-7-15(14)16(17)10-12-19(18,20)2/h1,6,15-18,21H,4-5,7-13H2,2H3/t15-,16+,17+,18-,19-,20-/m0/s1 |
| InChIKey | YNVGQYHLRCDXFQ-XGXHKTLJSA-N |
| SMILES | O[C@@]1([C@@]2([C@H]([C@H]3[C@@H]([C@H]4CCCC=C4CC3)CC2)CC1)C)C#C |
| CAS DataBase Reference | 52-76-6 |
| EPA Substance Registry System | Lynestrenol (52-76-6) |
Description and Uses
Progestogen;Antioestrogen
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Warning |
| Hazard statements | H351-H361 |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| RTECS | RC8964300 |
| HS Code | 2937230000 |
| Hazardous Substances Data | 52-76-6(Hazardous Substances Data) |




