A4013512
Entecavir Hydrate , ≥99% , 209216-23-9
Synonym(s):
2-Amino-1,9-dihydro-9-[(1S,3R,4S)-4-hydroxy-3-(hydroxymethyl)-2-methylenecyclopentyl]-6H-purin-6-one monohydrate
CAS NO.:209216-23-9
Empirical Formula: C12H17N5O4
Molecular Weight: 295.3
MDL number: MFCD09754448
EINECS: 606-668-5
| Pack Size | Price | Stock | Quantity |
| 5MG | RMB23.20 | In Stock |
|
| 10MG | RMB47.20 | In Stock |
|
| 50MG | RMB84.00 | In Stock |
|
| 250mg | RMB218.40 | In Stock |
|
| 1g | RMB792.80 | In Stock |
|
| 5g | RMB2639.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >220° |
| alpha | D +35.0° (c = 0.38 in water) |
| Density | 1.81 |
| storage temp. | Keep in dark place,Sealed in dry,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Sparingly), Water (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,3595 |
| Major Application | pharmaceutical |
| InChI | InChI=1/C12H15N5O3.H2O/c1-5-6(3-18)8(19)2-7(5)17-4-14-9-10(17)15-12(13)16-11(9)20;/h4,6-8,18-19H,1-3H2,(H3,13,15,16,20);1H2/t6-,7-,8-;/s3 |
| InChIKey | YXPVEXCTPGULBZ-UQHDSAJHNA-N |
| SMILES | C=C1[C@@H]([C@@H](O)C[C@@H]1N1C=NC2C(NC(N)=NC1=2)=O)CO.O |&1:2,3,6,r| |
| CAS DataBase Reference | 209216-23-9(CAS DataBase Reference) |
Description and Uses
Entecavir Monohydrate could be a useful compound for treating hepatitis virus B infection.
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H351-H372 |
| Precautionary statements | P201-P202-P260-P264-P270-P308+P313 |
| target organs | Liver |
| Safety Statements | 24/25 |
| WGK Germany | WGK 3 |
| HS Code | 29339900 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Carc. 2 STOT RE 1 |






