A4017412
3-Ethoxypropionitrile , ≥99.0%(GC) , 2141-62-0
CAS NO.:2141-62-0
Empirical Formula: C5H9NO
Molecular Weight: 99.13
MDL number: MFCD00001959
EINECS: 218-393-4
| Pack Size | Price | Stock | Quantity |
| 25ml | RMB38.40 | In Stock |
|
| 100ML | RMB103.20 | In Stock |
|
| 500ML | RMB273.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 48.9 °C |
| Boiling point: | 171°C |
| Density | 0.894 |
| refractive index | 1.4075 |
| Flash point: | 64°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| BRN | 741924 |
| CAS DataBase Reference | 2141-62-0(CAS DataBase Reference) |
| NIST Chemistry Reference | C2H5CH(OC2H5)CH2CN(2141-62-0) |
| EPA Substance Registry System | Propanenitrile, 3-ethoxy- (2141-62-0) |
Description and Uses
3-Ethoxypropionitrile is used as thiadiazole derivatives; pharmaceutical intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36-37 |
| RIDADR | 3276 |
| RTECS | TZ4680000 |
| TSCA | TSCA listed |
| HS Code | 29269090 |





