A4023912
7-Ethylcamptothecin , ≥96.0%(HPLC) , 78287-27-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB31.20 | In Stock |
|
| 250MG | RMB48.80 | In Stock |
|
| 1G | RMB154.40 | In Stock |
|
| 5G | RMB716.00 | In Stock |
|
| 25g | RMB3054.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 236-241°C |
| Boiling point: | 752.9±60.0 °C(Predicted) |
| Density | 1.43 |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform and Methanol Mixture (Slightly, Heated, Sonicated), DMSO (Slightly, Heated) |
| form | Solid |
| pka | 11.24±0.20(Predicted) |
| color | Pale Yellow to Light Orange |
| InChI | InChI=1S/C22H20N2O4/c1-3-12-13-7-5-6-8-17(13)23-19-14(12)10-24-18(19)9-16-15(20(24)25)11-28-21(26)22(16,27)4-2/h5-9,27H,3-4,10-11H2,1-2H3/t22-/m0/s1 |
| InChIKey | MYQKIWCVEPUPIL-JOCHJYFZSA-N |
| SMILES | N1C2C(=CC=CC=2)C(CC)=C2CN3C(C=12)=CC1[C@](CC)(O)C(=O)OCC=1C3=O |
| CAS DataBase Reference | 78287-27-1(CAS DataBase Reference) |
Description and Uses
An anticancer drug, showed strong activity against various murine tumors. A Camptothecin (CPT) derivative as antineoplastic agent against drug-resistant tumors. Irinotecan USP Related Compound E.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H311+H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P310+P330-P302+P352+P312+P361+P364-P304+P340+P311-P403+P233-P405-P501 |
| Risk Statements | 23/34/35 |
| Safety Statements | 3/14-6-36/37/39 |
| RIDADR | 1544 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
![12-ethyl-8-methyl-9-oxo-7-propionyl-9,11-dihydroindolizino[1,2-b]quinolin-2-yl [1,4'-bipiperidine]-1'-carboxylate](https://img.chemicalbook.com/CAS/20180703/GIF/176515-52-9.gif)