A4024912
Ethyl Linoleate , ≥97.0%(GC) , 544-35-4
Synonym(s):
Linoleic acid ethyl ester
CAS NO.:544-35-4
Empirical Formula: C20H36O2
Molecular Weight: 308.5
MDL number: MFCD00009535
EINECS: 208-868-4
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB59.20 | In Stock |
|
| 25ML | RMB242.40 | In Stock |
|
| 100ml | RMB493.60 | In Stock |
|
| 500ml | RMB2172.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 224 °C/17 mmHg (lit.) |
| Density | 0.876 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 110°C |
| storage temp. | -20°C |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colourless |
| Odor | at 100.00 %. mild fatty fruity oily |
| Odor Type | fatty |
| biological source | plant oil (safflower) |
| Merck | 14,3820 |
| BRN | 1727827 |
| Cosmetics Ingredients Functions | SKIN CONDITIONING - EMOLLIENT PERFUMING |
| InChI | 1S/C20H36O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22-4-2/h8-9,11-12H,3-7,10,13-19H2,1-2H3/b9-8-,12-11- |
| InChIKey | FMMOOAYVCKXGMF-MURFETPASA-N |
| SMILES | CCCCC\C=C/C\C=C/CCCCCCCC(=O)OCC |
| LogP | 8.173 (est) |
| CAS DataBase Reference | 544-35-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Linoleic acid ethyl ester(544-35-4) |
| EPA Substance Registry System | 9,12-Octadecadienoic acid (9Z,12Z)-, ethyl ester (544-35-4) |
Description and Uses
Labelled Ethyl Linoleate (E924300). A fatty acid alkyl ester used in the vitamin industry.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Safety Statements | 23-24/25 |
| WGK Germany | 1 |
| RTECS | RG2185000 |
| F | 8-10 |
| TSCA | TSCA listed |
| HS Code | 29161500 |
| Storage Class | 10 - Combustible liquids |



