A4025156
3-Chloro-4-fluorophenylisocyanate , 98% , 50529-33-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB111.20 | In Stock |
|
| 5g | RMB391.20 | In Stock |
|
| 25g | RMB1335.20 | In Stock |
|
| 100g | RMB4415.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 44 °C17 mm Hg(lit.) |
| Density | 1.377 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 190 °F |
| storage temp. | Refrigerator (+4°C) |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Sensitive | Moisture Sensitive |
| BRN | 973324 |
| InChI | InChI=1S/C7H3ClFNO/c8-6-3-5(10-4-11)1-2-7(6)9/h1-3H |
| InChIKey | XVIPJBUXMFLHSI-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(N=C=O)C=C1Cl |
| CAS DataBase Reference | 50529-33-4(CAS DataBase Reference) |
Description and Uses
3-Chloro-4-fluorophenyl Isocyanate was used in bicycloalkyl urea MCH receptor antagonists preparation as oral antiobesity drugs.
Safety
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H227-H300-H315-H319-H330-H334-H335 |
| Precautionary statements | P301+P310a-P304+P340-P305+P351+P338-P320-P330-P405-P501a |
| Hazard Codes | Xn,T,Xi |
| Risk Statements | 20/21/22-36/37/38-42-25-23 |
| Safety Statements | 26-36/37/39-45-23 |
| RIDADR | UN 2206 6.1/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29291000 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |
