A4029912
Ethyl 3-Amino-2-butenoate , ≥98.0%(GC) , 7318-00-5
CAS NO.:7318-00-5
Empirical Formula: C6H11NO2
Molecular Weight: 129.16
MDL number: MFCD00008073
EINECS: 230-782-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB35.20 | In Stock |
|
| 100g | RMB130.40 | In Stock |
|
| 250g | RMB295.20 | In Stock |
|
| 1kg | RMB775.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 33-35 °C(lit.) |
| Boiling point: | 210-215 °C(lit.) |
| Density | 1.022 g/mL at 25 °C(lit.) |
| refractive index | 1.5-1.502 |
| Flash point: | 207 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Methanol |
| form | Low Melting Solid or Liquid |
| pka | 5.32±0.70(Predicted) |
| color | Slightly yellow |
| InChI | InChI=1S/C6H11NO2/c1-3-9-6(8)4-5(2)7/h4H,3,7H2,1-2H3 |
| InChIKey | YPMPTULBFPFSEQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C=C(N)C |
| CAS DataBase Reference | 7318-00-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Butenoic acid, 3-amino-, ethyl ester(7318-00-5) |
Description and Uses
Ethyl 3-Aminocrotonate is used as a reagent to synthesize Nitrendipine (N490150), a calcium channel antagonist that is used to treat patients with hypertension. Ethyl 3-Aminocrotonate is also used as a reagent to synthesize (S)-Felodipine (F232370), a calcium entry blocker that has antihypertensive properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | C |
| Risk Statements | 34-36/37 |
| Safety Statements | 26-27-28-36/37/39-45-24/25 |
| RIDADR | UN 3263 8/PG 2 |
| WGK Germany | 3 |
| HS Code | 29224999 |







