A4031612
Ethyl <I>N</I>-Boc-piperidine-4-carboxylate , 97% , 142851-03-4
Synonym(s):
Ethyl 1-(tert-butoxycarbonyl)-4-piperidinecarboxylate;Ethyl 1-(tert-Butyloxycarbonyl)isonipecotate;Piperidine-1,4-dicarboxylic acid 1-tert-butyl ester 4-ethyl ester
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB84.80 | In Stock |
|
| 100G | RMB207.20 | In Stock |
|
| 500g | RMB718.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 120-135 °C/0.5 mmHg |
| Density | 1.046 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethyl Acetate |
| pka | -2.23±0.40(Predicted) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| InChI | InChI=1S/C13H23NO4/c1-5-17-11(15)10-6-8-14(9-7-10)12(16)18-13(2,3)4/h10H,5-9H2,1-4H3 |
| InChIKey | MYHJCTUTPIKNAT-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC(C(OCC)=O)CC1 |
| CAS DataBase Reference | 142851-03-4(CAS DataBase Reference) |
Description and Uses
Substrate used in a palladium-catalyzed α-arylation of esters with heterocyclic bromides and chlorides leading to, for example, 4-pyridylpiperidinyl esters.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |





