A4032912
4-Ethynylbenzoic acid , ≥95% , 10602-00-3
Synonym(s):
4-Carboxyphenylacetylene
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB51.20 | In Stock |
|
| 1G | RMB132.00 | In Stock |
|
| 5G | RMB433.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 200°C |
| Boiling point: | 277.2±23.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.95±0.10(Predicted) |
| form | powder or crystals |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H6O2/c1-2-7-3-5-8(6-4-7)9(10)11/h1,3-6H,(H,10,11) |
| InChIKey | SJXHLZCPDZPBPW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C#C)C=C1 |
Description and Uses
4-Ethynylbenzoic acid may be used in the synthesis of N-(4-ethynylphenylcarbonyl) L-glutamic acid diethyl ester, a precursor for synthesizing glutamic acid-based dendritic helical poly(phenylacetylene)s. It can also be used to prepare zinc porphyrins attached to various cyclic aromatic hydrocarbon substituents, which can act as potential photo-sensitizers for dye-sensitized solar cells (DSSCs). This product was previously listed as CBR01612.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-36-22 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | WGK 3 |
| HS Code | 2916399090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |







