A4035412
Ethyl chlorofluoroacetate , >98.0%(GC) , 401-56-9
CAS NO.:401-56-9
Empirical Formula: C4H6ClFO2
Molecular Weight: 140.54
MDL number: MFCD00039333
EINECS: 206-930-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB120.00 | In Stock |
|
| 25G | RMB432.00 | In Stock |
|
| 100g | RMB1368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 133 °C (lit.) |
| Density | 1.212 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 125 °F |
| storage temp. | Storage temp. 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.225 |
| BRN | 1748679 |
| InChI | InChI=1S/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3 |
| InChIKey | WUHVJSONZHSDFC-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)F |
| CAS DataBase Reference | 401-56-9(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, chlorofluoro-, ethyl ester (401-56-9) |
Description and Uses
Ethyl chlorofluoroacetate may be used in the synthesis of:
- chlorofluoroacetamide
- ethyl α-fluoro silyl enol ether
- chlorofluoroacetyl chloride
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,F,Xi |
| Risk Statements | 10-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2920 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




