A4038812
Ethyl O-(2-mesitylenesulfonyl)acethydroxamate , ≥98.0% , 38202-27-6
Synonym(s):
O-(2-Mesitylenesulfonyl)acethydroxamic acid ethyl ester
CAS NO.:38202-27-6
Empirical Formula: C13H19NO4S
Molecular Weight: 285.36
MDL number: MFCD00009244
EINECS: 253-825-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB33.60 | In Stock |
|
| 1G | RMB52.56 | In Stock |
|
| 5G | RMB195.20 | In Stock |
|
| 25G | RMB598.40 | In Stock |
|
| 100g | RMB1827.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54-56 °C (lit.)
54-58 °C |
| Boiling point: | 381.7±52.0 °C(Predicted) |
| Density | 1.2483 (rough estimate) |
| refractive index | 1.6800 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Insoluble |
| BRN | 2144156 |
| InChI | InChI=1S/C13H19NO4S/c1-6-17-12(5)14-18-19(15,16)13-10(3)7-9(2)8-11(13)4/h7-8H,6H2,1-5H3 |
| InChIKey | KQCBSWBQAXTILK-UHFFFAOYSA-N |
| SMILES | C(=NOS(C1=C(C)C=C(C)C=C1C)(=O)=O)(OCC)C |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 6-9-21 |
| HS Code | 29252900 |
| Storage Class | 11 - Combustible Solids |





