A4042112
<i>exo</i>-Norborneol , >98.0%(GC) , 497-37-0
CAS NO.:497-37-0
Empirical Formula: C7H12O
Molecular Weight: 112.17
MDL number: MFCD00136051
EINECS: 207-845-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB71.20 | In Stock |
|
| 5G | RMB282.40 | In Stock |
|
| 25G | RMB854.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 124-126 °C(lit.) |
| Boiling point: | 176-177 °C(lit.) |
| Density | 0.9086 (rough estimate) |
| refractive index | 1.4460 (estimate) |
| storage temp. | Refrigerator |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 15.31±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | 1S/C7H12O/c8-7-4-5-1-2-6(7)3-5/h5-8H,1-4H2/t5-,6+,7+/m1/s1 |
| InChIKey | ZQTYQMYDIHMKQB-VQVTYTSYSA-N |
| SMILES | O[C@H]1C[C@@H]2CC[C@H]1C2 |
| EPA Substance Registry System | Exo-norborneol (497-37-0) |
Description and Uses
exo-Norborneol was used in the synthesis of cyclic ketones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 2906190090 |
| Storage Class | 11 - Combustible Solids |







