A4047712
Ethyl 6-Hydroxyhexanoate , >95.0%(GC) , 5299-60-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB86.40 | In Stock |
|
| 25g | RMB291.20 | In Stock |
|
| 100g | RMB1015.20 | In Stock |
|
| 500g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 127-128 °C/12 mmHg (lit.) |
| Density | 0.985 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 15.15±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| InChI | InChI=1S/C8H16O3/c1-2-11-8(10)6-4-3-5-7-9/h9H,2-7H2,1H3 |
| InChIKey | HYXRUZUPCFVWAH-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCCO |
| LogP | 0.917 (est) |
Description and Uses
Ethyl 6-Hydroxyhexanoate is used as a reagent in the synthesis of cross-reactive carbohydrate determinants (CCDs) as tools for in vitro allergy diagnosis. Ethyl 6-Hydroxyhexanoate is also used in the preparation of N-5-Carboxypentyl-1-deoxymannojirimycin (C181150); a ligand used for the preparation of an affinity resin specific for Man9 mannosidase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2918.19.9000 |
