A4048512
Ethyl <i>N</i>-(<i>tert</i>-Butoxycarbonyl)-<small>D</small>-pyroglutamate , >95.0%(HPLC) , 144978-35-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB78.40 | In Stock |
|
| 25G | RMB196.00 | In Stock |
|
| 100G | RMB535.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 54.0 to 58.0 °C |
| Boiling point: | 375.0±35.0 °C(Predicted) |
| Density | 1.182±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -4.15±0.40(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C12H19NO5/c1-5-17-10(15)8-6-7-9(14)13(8)11(16)18-12(2,3)4/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | YWWWGFSJHCFVOW-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)C(=O)CC[C@@H]1C(OCC)=O |
Description and Uses
1-Boc-D-Pyroglutamic acid ethyl ester is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research. It could synthesise (2S,5S)-N-Boc-5-methylpyrrolidine-2-carboxylic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| HS Code | 2933.79.8500 |
