A4052312
Ethyl 5-Bromovalerate , >97.0%(GC) , 14660-52-7
CAS NO.：14660-52-7
Empirical Formula: C7H13BrO2
Molecular Weight: 209.08
MDL number: MFCD00000266
EINECS: 238-705-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB127.20 | In Stock |
|
| 25G | RMB399.20 | In Stock |
|
| 100G | RMB1279.20 | In Stock |
|
| 500g | RMB3999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 104-109 °C/12 mmHg (lit.) |
| Density | 1.321 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 219 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Light Sensitive |
| BRN | 1752023 |
| InChI | InChI=1S/C7H13BrO2/c1-2-10-7(9)5-3-4-6-8/h2-6H2,1H3 |
| InChIKey | AFRWBGJRWRHQOV-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCCCBr |
| CAS DataBase Reference | 14660-52-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentanoic acid, 5-bromo-, ethyl ester(14660-52-7) |
Description and Uses
Ethyl 5-bromovalerate is employed in the preparation of S(γ-Carboxypropyl)-DL-homocysteine and S(δ-Carboxybutyl)-DL-homocysteine. It is also used in the preparation of ethyl 5-azidovalerate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 8-10 |
| HS Code | 29159000 |
