A4054912
Ethyl (2-Amino-4-thiazolyl)acetate , >98.0% , 53266-94-7
CAS NO.:53266-94-7
Empirical Formula: C7H10N2O2S
Molecular Weight: 186.23
MDL number: MFCD00005330
EINECS: 258-452-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5g | RMB24.00 | In Stock |
|
| 25G | RMB78.40 | In Stock |
|
| 100g | RMB195.20 | In Stock |
|
| 500G | RMB863.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 92-94 °C (lit.) |
| Boiling point: | 318.5±17.0 °C(Predicted) |
| Density | 1.2900 (rough estimate) |
| refractive index | 1.5400 (estimate) |
| Flash point: | 185 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | 3.72±0.10(Predicted) |
| color | Slightly yellow to beige |
| BRN | 139617 |
| InChI | InChI=1S/C7H10N2O2S/c1-2-11-6(10)3-5-4-12-7(8)9-5/h4H,2-3H2,1H3,(H2,8,9) |
| InChIKey | SHQNGLYXRFCPGZ-UHFFFAOYSA-N |
| SMILES | S1C=C(CC(OCC)=O)N=C1N |
| CAS DataBase Reference | 53266-94-7(CAS DataBase Reference) |
Description and Uses
Ethyl 2-Amino-4-thiazoleacetate, is a versatile building block for the synthesis of various pharmaceutical and biologically active compounds including inhibitors and antibiotics. It is used in the synthesis of Cefdinir (C242675) derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36 |
| WGK Germany | 3 |
| F | 23 |
| HazardClass | IRRITANT |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |




