A4056512
Ethyl 2-(2-Amino-4-thiazolyl)-2-oxoacetate , 96% , 64987-08-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB33.60 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25g | RMB143.20 | In Stock |
|
| 100G | RMB436.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 150-152 °C(lit.) |
| Boiling point: | 361.6±15.0 °C(Predicted) |
| Density | 1.405±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.35±0.10(Predicted) |
| color | Light Yellow to Yellow |
| InChI | InChI=1S/C7H8N2O3S/c1-2-12-6(11)5(10)4-3-13-7(8)9-4/h3H,2H2,1H3,(H2,8,9) |
| InChIKey | XNVRKLCQBZTGNA-UHFFFAOYSA-N |
| SMILES | C1(N=C(N)SC=1)C(=O)C(=O)OCC |
| CAS DataBase Reference | 64987-08-2(CAS DataBase Reference) |
Description and Uses
Ethyl 2-(2-Aminothiazol-4-yl)glyoxylate is used in the synthesis of antibacterial compounds. Also used in the synthesis of antiallergic and antiinflammatory agents, as glycolic amide derivatives.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P271-P260-P280 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| HS Code | 2934100090 |
