A4058412
Ethyl 5-Formyl-2,4-dimethyl-3-pyrrolecarboxylate , >98.0%(HPLC) , 2199-59-9
CAS NO.:2199-59-9
Empirical Formula: C10H13NO3
Molecular Weight: 195.22
MDL number: MFCD00030352
EINECS: 606-886-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB28.00 | In Stock |
|
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB164.80 | In Stock |
|
| 25g | RMB753.60 | In Stock |
|
| 100g | RMB2249.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 164.0 to 168.0 °C |
| Boiling point: | 358.4±42.0 °C(Predicted) |
| Density | 1.173±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 14.65±0.50(Predicted) |
| form | Solid |
| color | Beige |
| λmax | 297nm(EtOH)(lit.) |
| InChI | InChI=1S/C10H13NO3/c1-4-14-10(13)9-6(2)8(5-12)11-7(9)3/h5,11H,4H2,1-3H3 |
| InChIKey | GDISALBEIGGPER-UHFFFAOYSA-N |
| SMILES | N1C(C=O)=C(C)C(C(OCC)=O)=C1C |
| CAS DataBase Reference | 2199-59-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 5-Formyl-2,4-dimethyl-1H-pyrrole-3-carboxylic acid ethyl ester(2199-59-9) |
Description and Uses
5-ForMyl-2,4-diMethyl-1H-pyrrole-3-carboxylic Acid Ethyl Ester is used as an intermediate in the synthesis of receptor tyrosine kinase (RTK) inhibitors and their metabolites.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312-P302+P352-P304+P340-P305+P351+P338-P330-P332+P313-P337+P313-P362-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| HS Code | 2933998090 |




