A4064112
Ethyl Isocyanatoacetate , >97.0%(GC) , 2949-22-6
CAS NO.:2949-22-6
Empirical Formula: C5H7NO3
Molecular Weight: 129.11
MDL number: MFCD00002040
EINECS: 220-967-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB100.00 | In Stock |
|
| 5G | RMB330.40 | In Stock |
|
| 25G | RMB1015.20 | In Stock |
|
| 100G | RMB2847.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 67-68 °C/11 mmHg (lit.) |
| Density | 1.151 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 163 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | Liquid |
| Specific Gravity | 1.151 |
| color | Clear colorless |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| BRN | 970503 |
| InChI | InChI=1S/C5H7NO3/c1-2-9-5(8)3-6-4-7/h2-3H2,1H3 |
| InChIKey | DUVOZUPPHBRJJO-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CN=C=O |
| CAS DataBase Reference | 2949-22-6(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, isocyanato-, ethyl ester (2949-22-6) |
Description and Uses
Ethyl isocyanate is a carboxylate organic compound and can be used in various chemial synthesis.
Ethyl isocyanatoacetate has been used in the preparation of:
6-(carboxymethylureido)-(±)-nicotine (CMUNic), nicotine immunogen
ethyl 8-carbamoyl-4-oxo-3,4-dihydroimidazo[5,1-d]-1,2,3,5-tetrazin-3-ylacetate
imidazo[1,2-c]-quinazoline-2,5-(3H,6H)dione
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H319-H334-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-42 |
| Safety Statements | 23-26-36 |
| RIDADR | 2206 |
| WGK Germany | 3 |
| RTECS | AI4450000 |
| F | 21 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29291000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |








