A4069412
7-Ethyl-3-indoleethanol , ≥98.0% , 41340-36-7
CAS NO.：41340-36-7
Empirical Formula: C12H15NO
Molecular Weight: 189.25
MDL number: MFCD01718805
EINECS: 431-020-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB75.20 | In Stock |
|
| 25G | RMB142.40 | In Stock |
|
| 100g | RMB404.00 | In Stock |
|
| 500g | RMB1780.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 44-45°C |
| Boiling point: | 377.8±27.0 °C(Predicted) |
| Density | 1.146±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.98±0.10(Predicted) |
| color | White to Pale Beige |
| InChI | InChI=1S/C12H15NO/c1-2-9-4-3-5-11-10(6-7-14)8-13-12(9)11/h3-5,8,13-14H,2,6-7H2,1H3 |
| InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2CC)C(CCO)=C1 |
| CAS DataBase Reference | 41340-36-7(CAS DataBase Reference) |
Description and Uses
Key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H373-H412 |
| Precautionary statements | P273-P301+P312+P330-P314 |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-48/22-51/53 |
| Safety Statements | 2-36/37/39-61 |
| RIDADR | 3077 |
| RTECS | NL8512200 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2933998090 |
