PRODUCT Properties
| Boiling point: | 93-95 °C35 mm Hg(lit.) |
| Density | 1.038 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 139 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C7H8O3/c1-2-10-7(8)6-3-4-9-5-6/h3-5H,2H2,1H3 |
| InChIKey | LOFDXZJSDVCYAS-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OCC)=O)=C1 |
| LogP | 1.780 |
| CAS DataBase Reference | 614-98-2(CAS DataBase Reference) |
Description and Uses
Ethyl 3-furoate was used as starting reagent for the synthesis of ethyl 2,3-bis(trifluoromethyl)-7-oxabicyclo[2,2,1]hepta-2,5-diene-5-carboxylate and 4-(1-hydroxy-1-methyl-ethyl)-furan-2-sulfonamide.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Precautionary statements | P210-P233-P240-P241-P242-P243 |
| Hazard Codes | Xi,H226 |
| Safety Statements | 24/25 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29321900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






![Ethyl 4,5,6,7-tetrafluoro-2-methylbenzo[b]furan-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/3265-71-2.gif)
