A4074512
4,4'-Ethylenedianiline , >97.0%(GC) , 621-95-4
Synonym(s):
α,α′-Bi-p-toluidine;4,4′-Diaminobibenzyl
CAS NO.:621-95-4
Empirical Formula: C14H16N2
Molecular Weight: 212.29
MDL number: MFCD00007923
EINECS: 210-716-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB159.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25G | RMB2368.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-137 °C(lit.) |
| Boiling point: | 342.14°C (rough estimate) |
| Density | 0.9678 (rough estimate) |
| vapor pressure | 0.001Pa at 20℃ |
| refractive index | 1.4400 (estimate) |
| storage temp. | room temp |
| pka | 5.17±0.10(Predicted) |
| form | Powder |
| color | White to Gray to Brown |
| BRN | 394999 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H16N2/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h3-10H,1-2,15-16H2 |
| InChIKey | UHNUHZHQLCGZDA-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(N)C=C1)CC1=CC=C(N)C=C1 |
| LogP | 2.25 at 23℃ and pH7.7-8.6 |
| CAS DataBase Reference | 621-95-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 4,4'-(1,2-ethanediyl)bis-(621-95-4) |
| EPA Substance Registry System | Benzenamine, 4,4'-(1,2-ethanediyl)bis- (621-95-4) |
Description and Uses
4,4′-Ethylenedianiline may be used as an internal standard for the determination of 4,4′-methylenedianiline in urine samples using gas chromatography coupled with mass spectrometry (GC-MS).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36/37 |
| WGK Germany | 2 |
| RTECS | BY0200000 |
| TSCA | TSCA listed |
| HS Code | 2921.59.8090 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



