A4079912
2-Ethylhexyl Cyanoacetate , >98.0%(GC) , 13361-34-7
CAS NO.：13361-34-7
Empirical Formula: C11H19NO2
Molecular Weight: 197.27
MDL number: MFCD00019843
EINECS: 236-425-5
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB71.20 | In Stock |
|
| 25ML | RMB177.60 | In Stock |
|
| 100ML | RMB674.40 | In Stock |
|
| 500ML | RMB1974.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 150 °C11 mm Hg(lit.) |
| Density | 0.975 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 109 °C |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.01±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C11H19NO2/c1-3-5-6-10(4-2)9-14-11(13)7-8-12/h10H,3-7,9H2,1-2H3 |
| InChIKey | ZNYBQVBNSXLZNI-UHFFFAOYSA-N |
| SMILES | C(OCC(CC)CCCC)(=O)CC#N |
| CAS DataBase Reference | 13361-34-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Acetic acid, cyano-, 2-ethylhexyl ester(13361-34-7) |
| EPA Substance Registry System | Acetic acid, cyano-, 2-ethylhexyl ester (13361-34-7) |
Description and Uses
Organic intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P264-P270-P280-P301+P312+P330-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 2 |
| HS Code | 29269090 |
