A4081512
2-Ethyl-1,3-cyclopentanedione , >97.0% , 823-36-9
CAS NO.：823-36-9
Empirical Formula: C7H10O2
Molecular Weight: 126.15
MDL number: MFCD00044191
EINECS: 212-512-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB53.60 | In Stock |
|
| 25G | RMB113.60 | In Stock |
|
| 100g | RMB408.80 | In Stock |
|
| 500g | RMB1561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C |
| Boiling point: | 194.28°C (rough estimate) |
| Density | 1.0579 (rough estimate) |
| refractive index | 1.4660 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 10.87±0.20(Predicted) |
| color | White to Light yellow |
| PH | 2.94 at 24.3℃ and 10g/L |
| BRN | 1860068 |
| InChI | InChI=1S/C7H10O2/c1-2-5-6(8)3-4-7(5)9/h5H,2-4H2,1H3 |
| InChIKey | YDFBIBUYOUFJMR-UHFFFAOYSA-N |
| SMILES | C1(=O)CCC(=O)C1CC |
| LogP | 0.3 at 30℃ and pH7.69 |
| CAS DataBase Reference | 823-36-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,3-Cyclopentanedione, 2-ethyl-(823-36-9) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 2914290090 |
