A4083112
Ethyl (<i>S</i>)-(+)-3-Hydroxybutyrate , >96.0%(GC) , 56816-01-4
Synonym(s):
Ethyl (3S)-3-hydroxybutanoate
CAS NO.:56816-01-4
Empirical Formula: C6H12O3
Molecular Weight: 132.16
MDL number: MFCD00066206
EINECS: 260-393-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB317.60 | In Stock |
|
| 25G | RMB968.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 43 º (C=1, CHLOROFORM) |
| Boiling point: | 180-182 °C (lit.) |
| Density | 1.012 g/mL at 20 °C (lit.) |
| refractive index | n |
| Flash point: | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in chloroform |
| form | Liquid |
| pka | 14.45±0.20(Predicted) |
| color | Colorless to Yellow |
| optical activity | [α]20/D +43°, c = 1 in chloroform |
| BRN | 2347951 |
| InChI | InChI=1S/C6H12O3/c1-3-9-6(8)4-5(2)7/h5,7H,3-4H2,1-2H3/t5-/m0/s1 |
| InChIKey | OMSUIQOIVADKIM-YFKPBYRVSA-N |
| SMILES | C(OCC)(=O)C[C@@H](O)C |
| LogP | -0.019 (est) |
| CAS DataBase Reference | 56816-01-4(CAS DataBase Reference) |
Description and Uses
Ethyl (S)-3-hydroxybutyrate is a chiral building block for the preparation of bioactive compounds such as pheromones and carbapenem antibiotics.
Ethyl (S)-3-hydroxybutyrate may be used in the preparation of 3-(1′-hydroxyethyl)-2-azetidinones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227 |
| Precautionary statements | P210e-P280a-P370+P378a-P403+P235-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| HS Code | 29181990 |
| Storage Class | 10 - Combustible liquids |




