A4083812
Ethyl 2-Chloro-2-(hydroxyimino)acetate , ≥98.0%(T) , 14337-43-0
Synonym(s):
1-Ethyl oxalyl chloride 2-oxime
CAS NO.:14337-43-0
Empirical Formula: C4H6ClNO3
Molecular Weight: 151.55
MDL number: MFCD00010209
EINECS: 604-347-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB60.80 | In Stock |
|
| 25G | RMB179.20 | In Stock |
|
| 100G | RMB610.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 70-76 °C (lit.) |
| Boiling point: | 230.5±23.0 °C(Predicted) |
| Density | 1.36±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.60±0.10(Predicted) |
| color | White to Almost white |
| Sensitive | Moisture Sensitive/Lachrymatory |
| BRN | 606193 |
| InChI | InChI=1S/C4H6ClNO3/c1-2-9-4(7)3(5)6-8/h8H,2H2,1H3 |
| InChIKey | UXOLDCOJRAMLTQ-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)=NO |
| CAS DataBase Reference | 14337-43-0(CAS DataBase Reference) |
Description and Uses
Ethyl 2-chloro-2-(hydroxyimino)acetate has been used:
- in the preparation of (+)-and ()-Δ2-isoxazolines
- in the synthesis of CIP-AS (), a chiral amino acid structurally related to glutamic acid, potential agonist at the ionotropic (±±)-2-amino-3-(3-hydroxy-5-methylisoxazol-4-yl)propionic acid (AMPA)-kainate receptors
- to generate ethoxycarbonylformonitrile oxide, in situ by treatment with sodium bicarbonate
- to prepare N-azirdinyloximes which on treatment with scandium triflate (418218) provide dihydro-oxadiazines
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H318-H334-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 37/38-41-42/43-36/37/38 |
| Safety Statements | 22-26-36/37/39-45-36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| F | 10-19-21 |
| HazardClass | 9 |
| HS Code | 29280000 |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |









