A4087812
Ethyl 4-Bromo-3-methylbenzoate , >98.0%(GC) , 160313-69-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB50.40 | In Stock |
|
| 5G | RMB59.20 | In Stock |
|
| 25G | RMB220.80 | In Stock |
|
| 100G | RMB665.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 275°C(lit.) |
| Density | 1.378±0.06 g/cm3(Predicted) |
| refractive index | 1.5460 to 1.5500 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C10H11BrO2/c1-3-13-10(12)8-4-5-9(11)7(2)6-8/h4-6H,3H2,1-2H3 |
| InChIKey | GIGDAWLJINYIFV-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C1=CC=C(Br)C(C)=C1 |
Description and Uses
Ethyl 4-Bromo-3-methylbenzoate is a methylbenzoate derivative. The substitution of halogen bromine atom increases its reactivity. It is a crucial compound that could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| HS Code | 2916399090 |
