A4141712
ethyl 6-bromo-4-chloroquinoline-3-carboxylate , 97% , 206257-39-8
CAS NO.：206257-39-8
Empirical Formula: C12H9BrClNO2
Molecular Weight: 314.56
MDL number: MFCD00173367
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB212.00 | In Stock |
|
| 1G | RMB480.00 | In Stock |
|
| 5G | RMB1640.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-102° |
| Boiling point: | 378.3±37.0 °C(Predicted) |
| Density | 1.578 |
| refractive index | 1.632 |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 0.98±0.27(Predicted) |
| Appearance | White to off-white Solid |
| Water Solubility | Immiscible in water. |
| InChI | InChI=1S/C12H9BrClNO2/c1-2-17-12(16)9-6-15-10-4-3-7(13)5-8(10)11(9)14/h3-6H,2H2,1H3 |
| InChIKey | YGMLKBFPHVLHGT-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC(Br)=CC=2)C(Cl)=C(C(OCC)=O)C=1 |
Description and Uses
Ethyl 6-bromo-4-chloroquinoline-3-carboxylate is used as pharmaceutical intermediates
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| HazardClass | IRRITANT |
| HS Code | 2933499090 |
