A4142931
1-Boc-4-(2-formylphenyl)piperazine , ≥97% , 174855-57-3
Synonym(s):
tert-Butyl 4-(2-formylphenyl)-1-piperazinecarboxylate;1-tert-Butoxycarbonyl-4-(2-formylphenyl)piperazine;2-(N-Boc-piperazin-1-yl)benzaldehyde
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB49.60 | In Stock |
|
| 1g | RMB131.20 | In Stock |
|
| 5g | RMB415.20 | In Stock |
|
| 25g | RMB1671.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-90 °C(lit.) |
| Boiling point: | 425.3±40.0 °C(Predicted) |
| Density | 1.154±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.48±0.10(Predicted) |
| form | solid |
| Appearance | Light yellow to yellow Solid |
| InChI | 1S/C16H22N2O3/c1-16(2,3)21-15(20)18-10-8-17(9-11-18)14-7-5-4-6-13(14)12-19/h4-7,12H,8-11H2,1-3H3 |
| InChIKey | FGJACYJASSSXNJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)c2ccccc2C=O |
Description and Uses
1-Boc-4-(2-formylphenyl)piperazine is used in the synthesis of melanocortin subtype-4 receptor (MC4R) agonists. MC4R is located in the hypothalamus and helps to regulate metabolism, feeding and reproductive behavior. Agonists to these receptors have shown to decrease feeding behaviors.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H317 |
| Precautionary statements | P280-P301+P310+P330-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-43 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Skin Sens. 1 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
