A4195712
3-Ethoxybenzoic acid , 97% , 621-51-2
CAS NO.:621-51-2
Empirical Formula: C9H10O3
Molecular Weight: 166.17
MDL number: MFCD00016517
EINECS: 210-690-7
| Pack Size | Price | Stock | Quantity |
| 10g | RMB479.20 | In Stock |
|
| 50g | RMB2095.20 | In Stock |
|
| 100G | RMB3085.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-140 °C (lit.) |
| Boiling point: | 254.38°C (rough estimate) |
| Density | 1.1708 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | 2-8°C |
| pka | 4.10±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| BRN | 509159 |
| InChI | InChI=1S/C9H10O3/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6H,2H2,1H3,(H,10,11) |
| InChIKey | DTFQMPQJMDEWKJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC(OCC)=C1 |
| CAS DataBase Reference | 621-51-2(CAS DataBase Reference) |
Description and Uses
3-Ethoxybenzoic acid is an important raw material and intermediate used in organic synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2918999090 |





