A4225712
3-exo-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol , 98% , 135-97-7
CAS NO.:135-97-7
Empirical Formula: C8H15NO
Molecular Weight: 141.21
MDL number: MFCD00078060
EINECS: 205-226-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB24.80 | In Stock |
|
| 1G | RMB62.40 | In Stock |
|
| 5g | RMB200.80 | In Stock |
|
| 25g | RMB685.60 | In Stock |
|
| 100g | RMB1879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 109° |
| Boiling point: | bp 241° |
| Density | 0.9938 (rough estimate) |
| refractive index | 1.4811 (estimate) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 3.80(at 15℃) |
| form | Solid |
| color | Off-White to Pale Beige |
| InChI | InChI=1/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8- |
| InChIKey | CYHOMWAPJJPNMW-RNLVFQAGNA-N |
| SMILES | [C@@]12([H])CC[C@@]([H])(C[C@H](O)C1)N2C |&1:0,4,7,r| |
| CAS DataBase Reference | 135-97-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Azabicyclo[3.2.1]octan-3-ol, 8-methyl-, exo-(135-97-7) |
Description and Uses
ψ-Tropine is used in the preparation of novel nicotinic receptor agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |

![3-exo-8-Methyl-8-azabicyclo[3.2.1]octan-3-ol](https://img.chemicalbook.com/CAS/GIF/135-97-7.gif)


![endo-8-Azabicyclo[3.2.1]octan-3-olhydrochloride](https://img.chemicalbook.com/CAS/GIF/14383-51-8.gif)

