A4227712
(E)-3-(3,4-Dimethoxyphenyl)acrylic acid , 95% , 14737-89-4
CAS NO.:14737-89-4
Empirical Formula: C11H12O4
Molecular Weight: 208.21
MDL number: MFCD00004387
EINECS: 238-801-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB41.60 | In Stock |
|
| 25g | RMB157.60 | In Stock |
|
| 100g | RMB539.20 | In Stock |
|
| 500g | RMB2527.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 181-183 °C(lit.) |
| Boiling point: | 367.4±27.0 °C(Predicted) |
| Density | 1.203 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.53±0.10(Predicted) |
| form | powder |
| color | White |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/b6-4+ |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-N |
| SMILES | C(O)(=O)/C=C/C1=CC=C(OC)C(OC)=C1 |
| CAS DataBase Reference | 14737-89-4(CAS DataBase Reference) |
Description and Uses
(E)-3,4-Dimethoxycinnamic acid is the less active isomer of 3,4-Dimethoxycinnamic acid. 3,4-Dimethoxycinnamic acid exerts anti-apoptotic effects on L-02 cells via the ROS-mediated signaling pathway[1]. Anti-apoptotic effects[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HS Code | 2918999090 |







