A4275712
9-Fluorenylmethanol , 99% , 24324-17-2
Synonym(s):
9-(Hydroxymethyl)fluorene;9-Fluorenylmethanol
CAS NO.:24324-17-2
Empirical Formula: C14H12O
Molecular Weight: 196.24
MDL number: MFCD00001139
EINECS: 246-167-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB28.00 | In Stock |
|
| 100G | RMB92.80 | In Stock |
|
| 500G | RMB408.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 105-107 °C (lit.) |
| Boiling point: | 293.14°C (rough estimate) |
| Density | 1.0304 (rough estimate) |
| refractive index | 1.5385 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| pka | 13.68±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to pale yellow |
| BRN | 2330017 |
| InChI | InChI=1S/C14H12O/c15-9-14-12-7-3-1-5-10(12)11-6-2-4-8-13(11)14/h1-8,14-15H,9H2 |
| InChIKey | XXSCONYSQQLHTH-UHFFFAOYSA-N |
| SMILES | C1(CO)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 24324-17-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Fluorene-9-methanol(24324-17-2) |
| EPA Substance Registry System | 9H-Fluorene-9-methanol (24324-17-2) |
Description and Uses
9-Fluorenylmethanol(FMOC-OH) acts as a N-protecting reagent, which is used in the synthesis of peptide. It is also used in the preparation of deoxynucleoside 9-fluorenemethyl phosphorodithioates. Further, it is used to prepare 9-(fluoromethyl)fluorene. In addition to this, it is involved in the electropolymerization with boron trifluoride diethyl etherate to yield low-potential electrodeposition of semiconducting poly(9-fluorenemethanol) film.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H320-H402 |
| Precautionary statements | P501-P273-P270-P264-P337+P313-P305+P351+P338-P301+P312+P330 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-27-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | Yes |
| HS Code | 29062900 |



