A4276412
3-Formylbenzonitrile , 99% , 24964-64-5
Synonym(s):
3-Cyanobenzaldehyde
CAS NO.：24964-64-5
Empirical Formula: C8H5NO
Molecular Weight: 131.13
MDL number: MFCD00003344
EINECS: 246-549-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB95.20 | In Stock |
|
| 100G | RMB281.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-78 °C(lit.) |
| Boiling point: | 210 °C(lit.) |
| Density | 1.1971 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| Flash point: | 209-210°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder or Chunks |
| color | White to light yellow |
| Water Solubility | insoluble |
| Sensitive | Air Sensitive |
| BRN | 2205751 |
| InChI | InChI=1S/C8H5NO/c9-5-7-2-1-3-8(4-7)6-10/h1-4,6H |
| InChIKey | HGZJJKZPPMFIBU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=CC(C=O)=C1 |
| CAS DataBase Reference | 24964-64-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Cyanobenzaldehyde(24964-64-5) |
Description and Uses
3-Cyanobenzaldehyde is used in the synthesis of 3-(6,6-dimethyl-5,6-dihydro-4H-benzo[7,8]chromeno[6,5-d]oxazol-2-yl)benzonitrile. It is an important raw material and intermediate used in organic synthesis, pharmaceuticals agrochemicals and dyestuff fields.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22-36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| F | 10 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269095 |
